ChemNet > CAS > 175277-36-8 1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one
175277-36-8 1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one
| product Name |
1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one |
| CAS No |
175277-36-8 |
| Synonyms |
1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethanone |
| Molecular Formula |
C11H7Cl2NO2 |
| Molecular Weight |
256.0848 |
| InChI |
InChI=1/C11H7Cl2NO2/c1-6(15)11-5-10(14-16-11)7-2-3-8(12)9(13)4-7/h2-5H,1H3 |
| Molecular Structure |
![175277-36-8 1-[3-(3,4-dichlorophenyl)isoxazol-5-yl]ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/cas/cas175277-36-8.gif)
|
| Density |
1.375g/cm3 |
| Melting point |
130℃ |
| Boiling point |
429.4°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
213.5°C |
| Vapour Pressur |
1.41E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
